14-Oxabicyclo[11.2.1]hexadeca-4,8-diene-12-carboxylic acid, 8-formyl-4,15,15-trimethyl-, (1R,4Z,8E,12S,13S)-
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
![14-Oxabicyclo[11.2.1]hexadeca-4,8-diene-12-carboxylic acid, 8-formyl-4,15,15-trimethyl-, (1R,4Z,8E,12S,13S)-](https://resource.bocsci.com/structure/87340-32-7.gif)
| Category | Others |
| Catalog number | BBF-05374 |
| CAS | 87340-32-7 |
| Molecular Weight | 334.45 |
| Molecular Formula | C20H30O4 |
Online Inquiry
Specification
| Synonyms | Oxabicyclo[11.2.1]hexadeca-4,8-diene-12-carboxylic acid, 8-formyl-4,15,15-trimethyl-, (1R,4Z,8E,12S,13S)-, 14- |
| IUPAC Name | (1R,4Z,8E,12S,13S)-8-formyl-4,15,15-trimethyl-14-oxabicyclo[11.2.1]hexadeca-4,8-diene-12-carboxylic acid |
| Canonical SMILES | CC1=CCCC(=CCCC(C2CC(CC1)C(O2)(C)C)C(=O)O)C=O |
| InChI | InChI=1S/C20H30O4/c1-14-6-4-7-15(13-21)8-5-9-17(19(22)23)18-12-16(11-10-14)20(2,3)24-18/h6,8,13,16-18H,4-5,7,9-12H2,1-3H3,(H,22,23)/b14-6-,15-8+/t16-,17+,18+/m1/s1 |
| InChI Key | QXVKGHACURAACX-MISJYZNWSA-N |
Recommended Products
| BBF-03884 | Formononetin | Inquiry |
| BBF-05762 | Cyclosporin B | Inquiry |
| BBF-04609 | 1,1-Dimethylbiguanide hydrochloride | Inquiry |
| BBF-05817 | Astaxanthin | Inquiry |
| BBF-00586 | Brefeldin A | Inquiry |
| BBF-00693 | Ansamitocin P-3 | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
