2-Heptyl-3-hydroxy-quinolone
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Others |
| Catalog number | BBF-03223 |
| CAS | 521313-35-9 |
| Molecular Weight | 259.34 |
| Molecular Formula | C16H21NO2 |
Online Inquiry
Description
2-Heptyl-3-hydroxy-quinolone is a quinoline derivative produced by Pseudomonas aeruginosa T-359. It has weak anti-Gram-positive bacteria activity.
Specification
| Synonyms | 2-Heptyl-3,4-quinolinediol; 3,4-Dihydroxy-2-heptylquinoline; B-A |
| IUPAC Name | 2-heptyl-3-hydroxy-1H-quinolin-4-one |
| Canonical SMILES | CCCCCCCC1=C(C(=O)C2=CC=CC=C2N1)O |
| InChI | InChI=1S/C16H21NO2/c1-2-3-4-5-6-11-14-16(19)15(18)12-9-7-8-10-13(12)17-14/h7-10,19H,2-6,11H2,1H3,(H,17,18) |
| InChI Key | CEIUIHOQDSVZJQ-UHFFFAOYSA-N |
Properties
| Appearance | Light Yellow Crystal |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| Boiling Point | 417.9±40.0°C |
| Melting Point | 182-183°C |
| Density | 1.132±0.06 g/cm3 |
Recommended Products
| BBF-04301 | Tulathromycin A | Inquiry |
| BBF-00969 | Homomycin | Inquiry |
| BBF-03816 | Milbemycin oxime | Inquiry |
| BBF-01729 | Hygromycin B | Inquiry |
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-05877 | Coenzyme Q10 | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
Recently viewed products
Guamecycline dihydrochloride | Methyl-12,19-diketo-oleananolate acetate | 2,7-Dichloronorlichexanthone | (3β,16β)-Lupane-3,16,28-triol, 3,16-dibenzoate | Deacetylravidomycin N-oxide | (2S,9S,10S,3'S,4'S,6'S)-4'-Deacetyl-griseusin A | Butylcycloheptylprodiginine | Gramicidin S dihydrochloride | 18-iso-acetyl-oleanolic acid | Indomethacin Morpholinylamide | 2-Heptyl-3-hydroxy-quinolone
