(4α,16α)-Kaurane-17,18-diol
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Others |
| Catalog number | BBF-05569 |
| CAS | 74365-75-6 |
| Molecular Weight | 306.48 |
| Molecular Formula | C20H34O2 |
| Purity | ≥96% |
Online Inquiry
Specification
| Synonyms | (4alpha,16alpha)-Kaurane-17,18-Diol; Kaurane-17,18-diol, (4α,16α)-; Kaurane-17,18-diol, (4alpha,16alpha)-; (13α)-Kaurane-17,18-diol; Ent-kauran-16,17-diol; ent-16β-kaurane-17,19-diol |
| IUPAC Name | ((4R,4aS,6aS,8R,9R,11aR,11bS)-4,11b-dimethyltetradecahydro-6a,9-methanocyclohepta[a]naphthalene-4,8-diyl)dimethanol |
| Canonical SMILES | CC1(CCCC2(C1CCC34C2CCC(C3)C(C4)CO)C)CO |
| InChI | InChI=1S/C20H34O2/c1-18(13-22)7-3-8-19(2)16(18)6-9-20-10-14(4-5-17(19)20)15(11-20)12-21/h14-17,21-22H,3-13H2,1-2H3/t14-,15+,16+,17-,18+,19+,20-/m0/s1 |
| InChI Key | BQTHAHCFODJOGN-QDWVOHSCSA-N |
Properties
| Appearance | Needles |
| Boiling Point | 431.9±18.0°C at 760 mmHg |
| Melting Point | 180-181°C |
| Density | 1.1±0.1 g/cm3 |
| Solubility | Soluble in Benzene, Ethyl Acetate |
Recommended Products
| BBF-05781 | Emodepside | Inquiry |
| BBF-00745 | Cefteram pivoxil | Inquiry |
| BBF-05763 | Cyclosporin C | Inquiry |
| BBF-03819 | Spinosyn A | Inquiry |
| BBF-05886 | Notoginsenoside R1 | Inquiry |
| BBF-03881 | Sancycline | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
