A-25822 M
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-03135 |
| CAS | 50886-40-3 |
| Molecular Weight | 453.70 |
| Molecular Formula | C30H47NO2 |
Online Inquiry
Description
A-25822 M is an azasteroid antibiotic produced by Geotrichum flavobrienneum. It has anti-fungal activity, and the MIC for fungi such as Candida albicans, Cryptococcus neoformans, Trichophyton mentacea, Phytoplastria, Saccharomyces cerevisiae, Saccharomyces cerevisiae, Microsporum, etc. is 0.321-1.25 μg/mL. Antibacterial activity is weak.
Specification
| IUPAC Name | [(1R,6aS,8S,10aS,12aR)-10a,12a-dimethyl-1-[(2R)-6-methyl-5-methylideneheptan-2-yl]-1,2,3,5,6,6a,7,8,9,10,11,12-dodecahydronaphtho[1,2-h]quinolin-8-yl] acetate |
| Canonical SMILES | CC(C)C(=C)CCC(C)C1CCN=C2C1(CCC3=C2CCC4C3(CCC(C4)OC(=O)C)C)C |
| InChI | InChI=1S/C30H47NO2/c1-19(2)20(3)8-9-21(4)26-14-17-31-28-25-11-10-23-18-24(33-22(5)32)12-15-29(23,6)27(25)13-16-30(26,28)7/h19,21,23-24,26H,3,8-18H2,1-2,4-7H3/t21-,23+,24+,26-,29+,30-/m1/s1 |
| InChI Key | BGQJSAIMFDZPAY-AKPZTOJLSA-N |
Properties
| Appearance | Powder |
| Antibiotic Activity Spectrum | fungi |
Recommended Products
| BBF-05781 | Emodepside | Inquiry |
| BBF-03881 | Sancycline | Inquiry |
| BBF-03753 | Baicalin | Inquiry |
| BBF-05827 | Spliceostatin A | Inquiry |
| BBF-03862 | Cefozopran hydrochloride | Inquiry |
| BBF-05806 | Zeaxanthin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
