A 58365 B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-03162 |
| CAS | 87896-53-5 |
| Molecular Weight | 281.26 |
| Molecular Formula | C13H15NO6 |
| Purity | >98% |
Online Inquiry
Description
A58365 B is an enzyme inhibitor produced by Streptomyces chromofuscus A58365.1. It has the effect of inhibiting angiotensin transferase (ACE).
Specification
| Synonyms | 2H-Quinolizine-7-propanoic acid, 4-carboxy-1,3,4,6-tetrahydro-9-hydroxy-6-oxo- |
| Storage | Store at -20°C |
| IUPAC Name | 7-(2-carboxyethyl)-9-hydroxy-6-oxo-1,2,3,4-tetrahydroquinolizine-4-carboxylic acid |
| Canonical SMILES | C1CC(N2C(=C(C=C(C2=O)CCC(=O)O)O)C1)C(=O)O |
| InChI | InChI=1S/C13H15NO6/c15-10-6-7(4-5-11(16)17)12(18)14-8(10)2-1-3-9(14)13(19)20/h6,9,15H,1-5H2,(H,16,17)(H,19,20) |
| InChI Key | UJJUUOQJYAUBKD-UHFFFAOYSA-N |
Properties
| Appearance | White Powder |
| Boiling Point | 608.3°C at 760 mmHg |
| Density | 1.54 g/cm3 |
| Solubility | Soluble in DMSO |
Recommended Products
| BBF-00664 | Alternariol | Inquiry |
| BBF-05808 | Triptolide | Inquiry |
| BBF-03516 | (±)-Naringenin | Inquiry |
| BBF-03427 | Tubercidin | Inquiry |
| BBF-05806 | Zeaxanthin | Inquiry |
| BBF-03884 | Formononetin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
