Aestivophoenin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Others |
| Catalog number | BBF-00048 |
| CAS | 171864-92-9 |
| Molecular Weight | 612.71 |
| Molecular Formula | C36H40N2O7 |
Online Inquiry
Description
Aestivophoenin is a nerve cell protective substance produced in Streptomyces purpeofuscus. Aestivophoenin B can reduce the toxicity of L-glutamate to Nl8-RE-105 cells, with an ECso of 6.2 nmol/L, and has an antioxidant effect.
Specification
| IUPAC Name | [(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl] 7-benzoyl-5,9-bis(3-methylbut-2-enyl)-10H-phenazine-1-carboxylate |
| Canonical SMILES | CC1C(C(C(C(O1)OC(=O)C2=C3C(=CC=C2)N(C4=CC(=CC(=C4N3)CC=C(C)C)C(=O)C5=CC=CC=C5)CC=C(C)C)O)O)O |
| InChI | InChI=1S/C36H40N2O7/c1-20(2)14-15-24-18-25(32(40)23-10-7-6-8-11-23)19-28-29(24)37-30-26(12-9-13-27(30)38(28)17-16-21(3)4)35(43)45-36-34(42)33(41)31(39)22(5)44-36/h6-14,16,18-19,22,31,33-34,36-37,39,41-42H,15,17H2,1-5H3/t22-,31-,33+,34+,36-/m0/s1 |
| InChI Key | ISXDPWVSFUTKTJ-FOZKTZISSA-N |
Properties
| Appearance | Orange Powder |
| Melting Point | 63-64°C |
Recommended Products
| BBF-03954 | Polymyxin B nonapeptide | Inquiry |
| BBF-03974 | Epigallocatechin gallate | Inquiry |
| BBF-03973 | Cefpirome sulfate | Inquiry |
| BBF-05762 | Cyclosporin B | Inquiry |
| BBF-03891 | Cefsulodin sodium | Inquiry |
| BBF-00969 | Homomycin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
