AM 4299 B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-03206 |
| CAS | 160825-49-0 |
| Molecular Weight | 373.40 |
| Molecular Formula | C16H27N3O7 |
| Purity | >98% |
Online Inquiry
Description
AM 4299 B is a thiol protease inhibitor produced by Chromelosporium fulvum M4299.
Specification
| Synonyms | N(sup 6)-(N-((3-Carboxyoxiranyl)carbonyl)-L-leucyl)-L-lysine hydrate |
| Storage | Store at -20°C |
| IUPAC Name | 3-[[(2S)-1-[[(5S)-5-amino-5-carboxypentyl]amino]-4-methyl-1-oxopentan-2-yl]carbamoyl]oxirane-2-carboxylic acid |
| Canonical SMILES | CC(C)CC(C(=O)NCCCCC(C(=O)O)N)NC(=O)C1C(O1)C(=O)O |
| InChI | InChI=1S/C16H27N3O7/c1-8(2)7-10(19-14(21)11-12(26-11)16(24)25)13(20)18-6-4-3-5-9(17)15(22)23/h8-12H,3-7,17H2,1-2H3,(H,18,20)(H,19,21)(H,22,23)(H,24,25)/t9-,10-,11?,12?/m0/s1 |
| InChI Key | ZVGQDSFLALZVNS-JYBOHDQNSA-N |
Properties
| Boiling Point | 749°C at 760 mmHg |
| Density | 1.316 g/cm3 |
| Solubility | Soluble in DMSO |
Recommended Products
| BBF-00664 | Alternariol | Inquiry |
| BBF-00693 | Ansamitocin P-3 | Inquiry |
| BBF-01729 | Hygromycin B | Inquiry |
| BBF-02594 | Pyrrolnitrin | Inquiry |
| BBF-03963 | Pristinamycin | Inquiry |
| BBF-05808 | Triptolide | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
