Antibiotic A-201D
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-03033 |
| CAS | 75076-80-1 |
| Molecular Weight | 628.63 |
| Molecular Formula | C29H36N6O10 |
Online Inquiry
Description
It is a nucleoside antibiotic produced by the strain of Streptomyces capreolus NRLL 3817. It has anti-gram-positive bacteria activity.
Specification
| Synonyms | A-201D |
| IUPAC Name | (E)-3-[4-[(5Z)-3,4-dihydroxy-5-(2-hydroxy-1-methoxyethylidene)oxolan-2-yl]oxyphenyl]-N-[5-[6-(dimethylamino)purin-9-yl]-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]-2-methylprop-2-enamide |
| Canonical SMILES | CC(=CC1=CC=C(C=C1)OC2C(C(C(=C(CO)OC)O2)O)O)C(=O)NC3C(OC(C3O)N4C=NC5=C4N=CN=C5N(C)C)CO |
| InChI | InChI=1S/C29H36N6O10/c1-14(9-15-5-7-16(8-6-15)43-29-23(40)22(39)24(45-29)18(11-37)42-4)27(41)33-19-17(10-36)44-28(21(19)38)35-13-32-20-25(34(2)3)30-12-31-26(20)35/h5-9,12-13,17,19,21-23,28-29,36-40H,10-11H2,1-4H3,(H,33,41)/b14-9+,24-18- |
| InChI Key | LZUIEYQNNYFARK-NLWRWPIZSA-N |
Properties
| Appearance | Crystal |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| Melting Point | 128-130°C |
| Solubility | Soluble in Ethanol, Methanol, Chloroform |
Recommended Products
| BBF-03891 | Cefsulodin sodium | Inquiry |
| BBF-00574 | Bestatin | Inquiry |
| BBF-03908 | Miltefosine | Inquiry |
| BBF-02575 | Pneumocandin A0 | Inquiry |
| BBF-03819 | Spinosyn A | Inquiry |
| BBF-00569 | Aspoxicillin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
