Arylomycin B1
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-00096 |
| CAS | |
| Molecular Weight | 869.97 |
| Molecular Formula | C42H59N7O13 |
Online Inquiry
Description
Arylomycin B is a lipopeptide compound with double aryl bridge produced by Streptomyces sp. Tu 6075. It has anti-Gram-positive bacteria activity. The most sensitive bacteria is Rhodococcus Ehmpolis. The B series compounds are more active than the corresponding A series compounds.
Specification
| IUPAC Name | (11S)-3,18-dihydroxy-14-[[2-[[(2R)-2-[[(2R)-3-hydroxy-2-[methyl(10-methylundecanoyl)amino]propanoyl]amino]propanoyl]amino]acetyl]-methylamino]-11-methyl-4-nitro-10,13-dioxo-9,12-diazatricyclo[13.3.1.12,6]icosa-1(18),2,4,6(20),15(19),16-hexaene-8-carboxylic acid |
| Canonical SMILES | CC1C(=O)NC(CC2=CC(=C(C(=C2)[N+](=O)[O-])O)C3=C(C=CC(=C3)C(C(=O)N1)N(C)C(=O)CNC(=O)C(C)NC(=O)C(CO)N(C)C(=O)CCCCCCCCC(C)C)O)C(=O)O |
| InChI | InChI=1S/C42H59N7O13/c1-23(2)13-11-9-7-8-10-12-14-34(52)47(5)32(22-50)40(57)44-24(3)38(55)43-21-35(53)48(6)36-27-15-16-33(51)28(20-27)29-17-26(19-31(37(29)54)49(61)62)18-30(42(59)60)46-39(56)25(4)45-41(36)58/h15-17,19-20,23-25,30,32,36,50-51,54H,7-14,18,21-22H2,1-6H3,(H,43,55)(H,44,57)(H,45,58)(H,46,56)(H,59,60)/t24-,25+,30?,32-,36?/m1/s1 |
| InChI Key | WFBZGMGSCAVZTQ-LTQNGAKSSA-N |
Properties
| Antibiotic Activity Spectrum | Gram-positive bacteria |
Recommended Products
| BBF-02576 | Pneumocandin B0 | Inquiry |
| BBF-03774 | Cephalosporin C Zinc Salt | Inquiry |
| BBF-05877 | Coenzyme Q10 | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-00693 | Ansamitocin P-3 | Inquiry |
| BBF-00969 | Homomycin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
