Asterriquinone SU5500
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-00121 |
| CAS | |
| Molecular Weight | 548.64 |
| Molecular Formula | C34H32N2O5 |
Online Inquiry
Description
Asterriquinone SU5500 is a quinone compounds containing indole produced by Aspergillus candidus. It has the effect of inhibiting the binding of Grb-2 adaptor (Adapter) to phosphorylated epidermal growth factor (EGF) receptor tyrosine kinase.
Specification
| Synonyms | 2,5-Bis[2-(3-methyl-2-butenyl)-1H-indole-3-yl]-3-acetoxy-6-hydroxy-1,4-benzoquinone |
| IUPAC Name | [4-hydroxy-2,5-bis[2-(3-methylbut-2-enyl)-1H-indol-3-yl]-3,6-dioxocyclohexa-1,4-dien-1-yl] acetate |
| Canonical SMILES | CC(=CCC1=C(C2=CC=CC=C2N1)C3=C(C(=O)C(=C(C3=O)OC(=O)C)C4=C(NC5=CC=CC=C54)CC=C(C)C)O)C |
| InChI | InChI=1S/C34H32N2O5/c1-18(2)14-16-25-27(21-10-6-8-12-23(21)35-25)29-31(38)32(39)30(34(33(29)40)41-20(5)37)28-22-11-7-9-13-24(22)36-26(28)17-15-19(3)4/h6-15,35-36,38H,16-17H2,1-5H3 |
| InChI Key | GLHSYPGYNYXAQE-UHFFFAOYSA-N |
Properties
| Appearance | Purple Powder |
Recommended Products
| BBF-03904 | Nosiheptide | Inquiry |
| BBF-03973 | Cefpirome sulfate | Inquiry |
| BBF-05806 | Zeaxanthin | Inquiry |
| BBF-05734 | Irofulven | Inquiry |
| BBF-02800 | DB-2073 | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
