Bagougeramine B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-00261 |
| CAS | 104840-34-8 |
| Molecular Weight | 612.68 |
| Molecular Formula | C24H44N12O7 |
Online Inquiry
Description
Bagougeramine B is produced by the strain of Bacillus circulans TB-2125. Both of A and B have activities against gram-positive bacteria and negative bacteria, and B has higher activity than A, except for Pseudomonas aeruginosa A3.
Specification
| Synonyms | beta-D-Glucopyranuronamide, N-(3-((4-aminobutyl)amino)propyl)-4-((3-((aminoiminomethyl)amino)-N-(N-methylglycyl)-D-alanyl)amino)-1-(4-amino-2-oxo-1(2H)-pyrimidinyl)-1,4-dideoxy- |
| IUPAC Name | (2S,3S,4S,5R,6R)-N-[3-(4-aminobutylamino)propyl]-6-(4-amino-2-oxopyrimidin-1-yl)-3-[[(2R)-3-(diaminomethylideneamino)-2-[[2-(methylamino)acetyl]amino]propanoyl]amino]-4,5-dihydroxyoxane-2-carboxamide |
| Canonical SMILES | CNCC(=O)NC(CN=C(N)N)C(=O)NC1C(C(C(OC1C(=O)NCCCNCCCCN)N2C=CC(=NC2=O)N)O)O |
| InChI | InChI=1S/C24H44N12O7/c1-29-12-15(37)33-13(11-32-23(27)28)20(40)35-16-17(38)18(39)22(36-10-5-14(26)34-24(36)42)43-19(16)21(41)31-9-4-8-30-7-3-2-6-25/h5,10,13,16-19,22,29-30,38-39H,2-4,6-9,11-12,25H2,1H3,(H,31,41)(H,33,37)(H,35,40)(H2,26,34,42)(H4,27,28,32)/t13-,16+,17+,18-,19+,22-/m1/s1 |
| InChI Key | LCASODQCASDDLN-WEYBRJQASA-N |
Properties
| Appearance | White Hygroscopic Powder |
| Antibiotic Activity Spectrum | gram-positive bacteria; gram-negative bacteria |
| Melting Point | 237 °C |
| Solubility | Soluble in water. |
Reference Reading
1. Bagougeramines A and B, new nucleoside antibiotics produced by a strain of Bacillus circulans. I. Taxonomy of the producing organism and isolation and biological properties of the antibiotics
A Takahashi, N Saito, K Hotta, Y Okami, H Umezawa J Antibiot (Tokyo). 1986 Aug;39(8):1033-40. doi: 10.7164/antibiotics.39.1033.
A bacterial isolate from soil, designated as TB-2125 had a unique pattern of multiple resistance to aminoglycoside antibiotics (AG) and produced new nucleoside antibiotics. Taxonomic properties of this strain fell into those of Bacillus circulans, providing unique characteristics such as strict susceptibility to acidic pH, motility of colony as well as multiple AG-resistance. Two new antibiotics which were named bagougeramines A and B had a broad antimicrobial activity and a specific activity against the two spotted spider mite.
2. Bagougeramines A and B, new nucleoside antibiotics produced by a strain of Bacillus circulans. II. Physico-chemical properties and structure determination
A Takahashi, D Ikeda, H Naganawa, Y Okami, H Umezawa J Antibiot (Tokyo). 1986 Aug;39(8):1041-6. doi: 10.7164/antibiotics.39.1041.
Bagougeramines A and B obtained as sulfates were soluble in water and positive to Sakaguchi, chlorine-tolidine and ninhydrin color reactions. Their structures were determined by acid hydrolysis and spectroscopic analysis. Structurally they were closely related to gougerotin and they contained the guanidino-D-alanine instead of the serine residue in gougerotin. Bagougeramine B had the spermidine instead of the 6'-NH2 in structure of bagougeramine A.
Recommended Products
| BBF-01729 | Hygromycin B | Inquiry |
| BBF-03816 | Milbemycin oxime | Inquiry |
| BBF-04624 | Sulbactam Sodium | Inquiry |
| BBF-03862 | Cefozopran hydrochloride | Inquiry |
| BBF-00664 | Alternariol | Inquiry |
| BBF-01210 | Emericid | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
