Boxazomycin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-00169 |
| CAS | 107021-65-8 |
| Molecular Weight | 300.27 |
| Molecular Formula | C14H12N4O4 |
Online Inquiry
Description
Boxazomycin B is an antibiotic produced by Pseudonocardia sp.G495-11. It has activity against gram-positive bacteria and anaerobic bacteria.
Specification
| IUPAC Name | 5-hydroxy-2-(5-hydroxy-2-methylpyrimidin-4-yl)-7-methyl-1,3-benzoxazole-4-carboxamide |
| Canonical SMILES | CC1=CC(=C(C2=C1OC(=N2)C3=NC(=NC=C3O)C)C(=O)N)O |
| InChI | InChI=1S/C14H12N4O4/c1-5-3-7(19)9(13(15)21)11-12(5)22-14(18-11)10-8(20)4-16-6(2)17-10/h3-4,19-20H,1-2H3,(H2,15,21) |
| InChI Key | ILGGOCYCDJJADI-UHFFFAOYSA-N |
Properties
| Appearance | Yellow Powder |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| Melting Point | >270°C(dec.) |
| Solubility | Soluble in DMF, Water, methyl ether, methanol, ethanol |
Recommended Products
| BBF-03862 | Cefozopran hydrochloride | Inquiry |
| BBF-05734 | Irofulven | Inquiry |
| BBF-02577 | Pneumocandin C0 | Inquiry |
| BBF-03800 | Moxidectin | Inquiry |
| BBF-03881 | Sancycline | Inquiry |
| BBF-01737 | Cordycepin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
