Brasiliquinone B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-00175 |
| CAS | 183201-04-9 |
| Molecular Weight | 336.34 |
| Molecular Formula | C20H16O5 |
Online Inquiry
Description
Brasiliquinone B is a benzo-onionquinone antibiotic produced by Nocardia brasiliensis, which has anti-gram-positive bacteria and tumor activity.
Specification
| Synonyms | (3S)-3-ethyl-6,8-dihydroxy-3,4-dihydrotetraphene-1,7,12(2H)-trione |
| IUPAC Name | (3S)-3-ethyl-6,8-dihydroxy-3,4-dihydro-2H-benzo[a]anthracene-1,7,12-trione |
| Canonical SMILES | CCC1CC2=CC(=C3C(=C2C(=O)C1)C(=O)C4=C(C3=O)C(=CC=C4)O)O |
| InChI | InChI=1S/C20H16O5/c1-2-9-6-10-8-14(23)17-18(15(10)13(22)7-9)19(24)11-4-3-5-12(21)16(11)20(17)25/h3-5,8-9,21,23H,2,6-7H2,1H3/t9-/m0/s1 |
| InChI Key | YXEPHAVILJDRHK-VIFPVBQESA-N |
Properties
| Appearance | Yellow Powder |
| Antibiotic Activity Spectrum | Gram-positive bacteria; neoplastics (Tumor) |
| Melting Point | 187-190°C |
| Solubility | Soluble in Methanol, chloroform, ethyl acetate, methyl ether |
Reference Reading
1. Brasiliquinones A, B and C, new benz[alpha]anthraquinone antibiotics from Nocardia brasiliensis. I. Producing strain, isolation and biological activities of the antibiotics
A Nemoto, Y Tanaka, Y Karasaki, H Komaki, K Yazawa, Y Mikami, T Tojo, K Kadowaki, M Tsuda, J Kobayashi J Antibiot (Tokyo). 1997 Jan;50(1):18-21. doi: 10.7164/antibiotics.50.18.
New benz[alpha]anthraquinone antibiotics (brasiliquinones A, B and C) with an ethyl group at C-3 were isolated. The producer was identified as Nocardia brasiliensis. The antibiotics were active against Gram-positive bacteria including Mycobacterium sp., but not active against Gram-negative bacteria or fungi. They were also active against multiple drug-resistant P388/ADR tumor cells.
Recommended Products
| BBF-03753 | Baicalin | Inquiry |
| BBF-02642 | Lactonamycin | Inquiry |
| BBF-01829 | Deoxynojirimycin | Inquiry |
| BBF-01825 | Loganin | Inquiry |
| BBF-00764 | Cerebroside C | Inquiry |
| BBF-00677 | 3-Amino-3-deoxy-D-glucose | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
