BU-1975C2
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-03262 |
| CAS | 53185-10-7 |
| Molecular Weight | 539.58 |
| Molecular Formula | C21H41N5O11 |
Online Inquiry
Description
BU-1975C2 is an antibiotic produced by Bacillus circulans, B. biotinicus, and B. proteophilus. It has strong inhibition of Escherichia coli and pneumoniae bacteria, and is clinically used for intestinal disinfection before surgery.
Specification
| Synonyms | Antibiotic BU 1975C2 |
| IUPAC Name | (2S)-4-amino-N-[(1R,2S,3R,4R,5S)-5-amino-4-[(2R,3R,4S,6S)-3-amino-6-(aminomethyl)-4-hydroxyoxan-2-yl]oxy-3-[(2S,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-2-hydroxycyclohexyl]-2-hydroxybutanamide |
| Canonical SMILES | C1C(OC(C(C1O)N)OC2C(CC(C(C2OC3C(C(C(O3)CO)O)O)O)NC(=O)C(CCN)O)N)CN |
| InChI | InChI=1S/C21H41N5O11/c22-2-1-10(28)19(33)26-9-4-8(24)17(36-20-13(25)11(29)3-7(5-23)34-20)18(14(9)30)37-21-16(32)15(31)12(6-27)35-21/h7-18,20-21,27-32H,1-6,22-25H2,(H,26,33)/t7-,8-,9+,10-,11-,12+,13+,14-,15+,16+,17+,18+,20+,21-/m0/s1 |
| InChI Key | CKUCUKKMHITAIF-FHZCHEQVSA-N |
Properties
| Antibiotic Activity Spectrum | Gram-negative bacteria |
Recommended Products
| BBF-03891 | Cefsulodin sodium | Inquiry |
| BBF-03827 | Polymyxin B sulphate | Inquiry |
| BBF-03937 | Pirarubicin | Inquiry |
| BBF-05843 | Bacitracin | Inquiry |
| BBF-02576 | Pneumocandin B0 | Inquiry |
| BBF-03427 | Tubercidin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
Recently viewed products
Arbekacin sulfate | Antibiotic 1100-50 | Spiro[4.5]dec-7-ene-1-hexanol, 9-hydroxy-8-(hydroxymethyl)-β,ζ,4-trimethyl-, [1R-[1α(βS*,ζR*),4β,5β(S*)]]- | Resorcinomycin A | 4'-O-Methylpaludosic acid | (2S,10R,3'S,4'S,6'S)-4'-Deacetylgriseusin B | 3-O-Demethyl-2'-N-glylfortimicin B | N-Benzoyl-D-leucinol | BU-1975C2
