β-Cyanoglutamic acid
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Bioactive by-products |
| Catalog number | BBF-01100 |
| CAS | |
| Molecular Weight | 172.14 |
| Molecular Formula | C8H6N2O4 |
Online Inquiry
Description
It is produced by the strain of Streptomyces sp. K749-42. It is an amino acid that has antifungal properties. It has anti-candida albicans effect. Its activity is similar to Cispentacin.
Specification
| Synonyms | Beta-Cyanoglutamic acid; 2-amino-3-cyano-pentanedioic acid |
| IUPAC Name | 2-amino-3-cyanopentanedioic acid |
| Canonical SMILES | C(C(C#N)C(C(=O)O)N)C(=O)O |
| InChI | InChI=1S/C6H8N2O4/c7-2-3(1-4(9)10)5(8)6(11)12/h3,5H,1,8H2,(H,9,10)(H,11,12) |
| InChI Key | ILQROMFBFXKCAZ-UHFFFAOYSA-N |
Properties
| Antibiotic Activity Spectrum | Fungi |
| Solubility | Soluble in Water |
Recommended Products
| BBF-05808 | Triptolide | Inquiry |
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-03827 | Polymyxin B sulphate | Inquiry |
| BBF-03816 | Milbemycin oxime | Inquiry |
| BBF-03963 | Pristinamycin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
