Diazaquinomycin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01383 |
| CAS | 87614-39-9 |
| Molecular Weight | 356.41 |
| Molecular Formula | C20H24N2O4 |
Online Inquiry
Description
Diazaquinomycin B is produced by the strain of Streptomyces sp.OM-704-KA333. It has anti-gram-positive bacterial activity and has antagonistic effect with metabolism of folic acid.
Specification
| IUPAC Name | 5,10-dihydroxy-3,7-dimethyl-4,6-dipropyl-1,9-dihydropyrido[3,2-g]quinoline-2,8-dione |
| Canonical SMILES | CCCC1=C(C(=O)NC2=C1C(=C3C(=C(C(=O)NC3=C2O)C)CCC)O)C |
| InChI | InChI=1S/C20H24N2O4/c1-5-7-11-9(3)19(25)21-15-13(11)17(23)14-12(8-6-2)10(4)20(26)22-16(14)18(15)24/h23-24H,5-8H2,1-4H3,(H,21,25)(H,22,26) |
| InChI Key | CAGVRPHICJWLCO-UHFFFAOYSA-N |
Properties
| Appearance | Colorless Acicular Crystalline |
| Antibiotic Activity Spectrum | Gram-positive bacteria |
| Melting Point | >300°C |
Recommended Products
| BBF-03800 | Moxidectin | Inquiry |
| BBF-03756 | Amygdalin | Inquiry |
| BBF-03774 | Cephalosporin C Zinc Salt | Inquiry |
| BBF-02582 | Polyporenic acid C | Inquiry |
| BBF-00693 | Ansamitocin P-3 | Inquiry |
| BBF-01729 | Hygromycin B | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
