Elsamicin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01205 |
| CAS | 97068-31-0 |
| Molecular Weight | 494.45 |
| Molecular Formula | C26H22O10 |
Online Inquiry
Description
Elsamicin B is produced by the strain of Actinomycetes J904-21. It is an antitumor antibiotic in the Chartreusin group. Aminoglycogen-deficient Elsamicin B shows only minimal antitumor activity.
Specification
| Synonyms | 10-[(3-C-Methyl-6-deoxy-β-D-galactopyranosyl)oxy]-6-hydroxy-1-methylbenzo[h][1]benzopyrano[5,4,3-cde][1]benzopyran-5,12-dione; Benzo(h)(1)benzopyrano(5,4,3-cde)(1)benzopyran-5,12-dione, 10-((6-deoxy-3-C-methyl-beta-D-galactopyranosyl)oxy)-6-hydroxy-1-methyl-; 6-Hydroxy-1-methyl-5,12-dioxo-5,12-dihydrobenzo[g][2]benzopyrano[5,4,3-cde][2]benzopyran-10-yl 6-deoxy-3-C-methylhexopyranoside |
| IUPAC Name | 8-hydroxy-15-methyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-4,6-dimethyloxan-2-yl]oxy-11,18-dioxapentacyclo[10.6.2.02,7.09,19.016,20]icosa-1(19),2(7),3,5,8,12(20),13,15-octaene-10,17-dione |
| Canonical SMILES | CC1C(C(C(C(O1)OC2=CC=CC3=C2C4=C5C6=C(C=CC(=C6C(=O)O4)C)OC(=O)C5=C3O)O)(C)O)O |
| InChI | InChI=1S/C26H22O10/c1-9-7-8-13-16-14(9)23(30)36-20-15-11(19(27)18(17(16)20)24(31)34-13)5-4-6-12(15)35-25-22(29)26(3,32)21(28)10(2)33-25/h4-8,10,21-22,25,27-29,32H,1-3H3/t10-,21+,22+,25?,26+/m1/s1 |
| InChI Key | HPVDVZANUAGIRR-CFSKDKRZSA-N |
Properties
| Appearance | Yellow Long Rod Crystal |
| Antibiotic Activity Spectrum | Neoplastics (Tumor) |
| Melting Point | 271-272 °C (dec.) |
| Solubility | Soluble in Pyridine, Methanol |
Reference Reading
1. Elsamicins, new antitumor antibiotics related to chartreusin. I. Production, isolation, characterization and antitumor activity
M Konishi, K Sugawara, F Kofu, Y Nishiyama, K Tomita, T Miyaki, H Kawaguchi J Antibiot (Tokyo). 1986 Jun;39(6):784-91. doi: 10.7164/antibiotics.39.784.
New antitumor antibiotics, elsamicins A and B, were isolated from the culture broth of an unidentified actinomycete strain J907-21 (ATCC 39417). They are structurally related to chartreusin, containing the common aglycone, chartarin, but contain different sugar moieties. Elsamicin A, the major component, has an amino sugar in the molecule which makes the antibiotic much more water-soluble than chartreusin. Elsamicin A exhibits strong inhibitory activity against various murine tumors including leukemia P388, leukemia L1210, and melanoma B16 but elsamicin B which lacks the amino sugar showed only marginal activity. The potency of elsamicin A was 10-30 times more potent than that of chartreusin in terms of minimum effective dose.
Recommended Products
| BBF-02642 | Lactonamycin | Inquiry |
| BBF-01825 | Loganin | Inquiry |
| BBF-05862 | Epirubicin | Inquiry |
| BBF-00677 | 3-Amino-3-deoxy-D-glucose | Inquiry |
| BBF-03754 | Castanospermine | Inquiry |
| BBF-02614 | Nystatin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
