Fluostatin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-01424 |
| CAS | 158906-40-2 |
| Molecular Weight | 326.30 |
| Molecular Formula | C18H14O6 |
Online Inquiry
Description
Fluostatin B is produced by the strain of Streptomyces sp. TA-3391. It inhibits the ability of DPP-III, and with arginyl-arginine-2-naphthalene formamide as the substrate, the IC50 is 24.0μg/mL.
Specification
| Synonyms | 2,3-Dihydro-3-methyl-1,2,6,7-tetrahydroxy-1H-benzo(a)fluorene-4,11-dione; 1H-Benzo[a]fluorene-4,11-dione,2,3-dihydro-1,2,6,7-tetrahydroxy-3-methyl-(9CI) |
| IUPAC Name | 1,2,6,7-tetrahydroxy-3-methyl-2,3-dihydro-1H-benzo[a]fluorene-4,11-dione |
| Canonical SMILES | CC1C(C(C2=C3C(=C(C=C2C1=O)O)C4=C(C3=O)C=CC=C4O)O)O |
| InChI | InChI=1S/C18H14O6/c1-6-15(21)8-5-10(20)13-11-7(3-2-4-9(11)19)17(23)14(13)12(8)18(24)16(6)22/h2-6,16,18-20,22,24H,1H3 |
| InChI Key | PLKATXVLQJQTSA-UHFFFAOYSA-N |
Properties
| Appearance | Orange Clubbed Crystalline |
| Boiling Point | 652°C at 760 mmHg |
| Melting Point | 266-269°C |
| Density | 1.639 g/cm3 |
Recommended Products
| BBF-00969 | Homomycin | Inquiry |
| BBF-03884 | Formononetin | Inquiry |
| BBF-05781 | Emodepside | Inquiry |
| BBF-04655 | Exatecan Mesylate | Inquiry |
| BBF-05880 | N-Me-L-Ala-maytansinol | Inquiry |
| BBF-01729 | Hygromycin B | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
