FR 900403
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-03564 |
| CAS | 131206-83-2 |
| Molecular Weight | 393.40 |
| Molecular Formula | C16H23N7O5 |
Online Inquiry
Description
FR 900403 is a nucleoside antibiotic originally isolated from Kernia sp. F-19849. It had anti-Candida activity, and the MIC against Candida albicans FP663 was 0.4 μg/mL.
Specification
| Synonyms | FR900403; beta-D-Ribofuranuronic acid, 3-((2-amino-3-methyl-1-oxopentyl)amino)-1-(6-amino-9H-purin-9-yl)-1,3-dideoxy- |
| IUPAC Name | 3-[(2-amino-3-methylpentanoyl)amino]-5-(6-aminopurin-9-yl)-4-hydroxyoxolane-2-carboxylic acid |
| Canonical SMILES | CCC(C)C(C(=O)NC1C(C(OC1C(=O)O)N2C=NC3=C(N=CN=C32)N)O)N |
| InChI | InChI=1S/C16H23N7O5/c1-3-6(2)7(17)14(25)22-8-10(24)15(28-11(8)16(26)27)23-5-21-9-12(18)19-4-20-13(9)23/h4-8,10-11,15,24H,3,17H2,1-2H3,(H,22,25)(H,26,27)(H2,18,19,20) |
| InChI Key | UGBUVVBCVYWCSO-UHFFFAOYSA-N |
Properties
| Appearance | Amorphous Powder |
| Antibiotic Activity Spectrum | fungi |
| Melting Point | 218-229°C |
| Density | 1.77±0.1 g/cm3 |
| Solubility | Soluble in Water, Methanol (Slightly) |
Recommended Products
| BBF-03754 | CASTANOSPERMINE | Inquiry |
| BBF-00677 | 3-Amino-3-deoxy-D-glucose | Inquiry |
| BBF-02642 | Lactonamycin | Inquiry |
| BBF-01829 | Deoxynojirimycin | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
| BBF-03753 | Baicalin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
