G 1499-2
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-03575 |
| CAS | 68978-12-1 |
| Molecular Weight | 267.36 |
| Molecular Formula | C18H21NO |
Online Inquiry
Description
It is produced by the strain of Cytophaga johnsonii. G 1499-2 can inhibit the growth of Flavobacterium, Staphylococcus aureus and Bacillus subtilis.
Specification
| Synonyms | Antibiotic G 1499-2; (+)-3-Methyl-2-(pentylidenecyclopropyl)-4(1H)-quinolinone; BRN 1485371 |
| IUPAC Name | 3-methyl-2-[(2E)-2-pentan-2-ylidenecyclopropyl]-1H-quinolin-4-one |
| Canonical SMILES | CCCC(=C1CC1C2=C(C(=O)C3=CC=CC=C3N2)C)C |
| InChI | InChI=1S/C18H21NO/c1-4-7-11(2)14-10-15(14)17-12(3)18(20)13-8-5-6-9-16(13)19-17/h5-6,8-9,15H,4,7,10H2,1-3H3,(H,19,20)/b14-11+ |
| InChI Key | QEKQMEQFJREWKU-SDNWHVSQSA-N |
Properties
| Appearance | White Crystalline |
| Antibiotic Activity Spectrum | Gram-positive bacteria; Gram-negative bacteria |
| Melting Point | 192-193°C |
| Solubility | Soluble in Acetone, Methanol, Ethyl Acetate and Chloroform |
Recommended Products
| BBF-00664 | Alternariol | Inquiry |
| BBF-03427 | Tubercidin | Inquiry |
| BBF-01851 | Fumagillin | Inquiry |
| BBF-00968 | Homoalanosine | Inquiry |
| BBF-05843 | Bacitracin | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
