GE20372 B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-03580 |
| CAS | |
| Molecular Weight | 611.69 |
| Molecular Formula | C30H41N7O7 |
Online Inquiry
Description
GE20372 B is a tetrapeptide produced by the strain of Streptomyces sp.. It is used as a human immunodeficiency virus (HIV-L) protease inhibitor.
Specification
| IUPAC Name | 2-[[5-(diaminomethylideneamino)-1-[[3-methyl-1-oxo-1-[[(2R)-1-oxo-3-phenylpropan-2-yl]amino]butan-2-yl]amino]-1-oxopentan-2-yl]carbamoylamino]-3-(4-hydroxyphenyl)propanoic acid |
| Canonical SMILES | CC(C)C(C(=O)NC(CC1=CC=CC=C1)C=O)NC(=O)C(CCCN=C(N)N)NC(=O)NC(CC2=CC=C(C=C2)O)C(=O)O |
| InChI | InChI=1S/C30H41N7O7/c1-18(2)25(27(41)34-21(17-38)15-19-7-4-3-5-8-19)37-26(40)23(9-6-14-33-29(31)32)35-30(44)36-24(28(42)43)16-20-10-12-22(39)13-11-20/h3-5,7-8,10-13,17-18,21,23-25,39H,6,9,14-16H2,1-2H3,(H,34,41)(H,37,40)(H,42,43)(H4,31,32,33)(H2,35,36,44)/t21-,23?,24?,25?/m1/s1 |
| InChI Key | DYNPEHYVIZVLIF-GRUCGOEVSA-N |
Recommended Products
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-03988 | Gamithromycin | Inquiry |
| BBF-05880 | N-Me-L-Ala-maytansinol | Inquiry |
| BBF-00586 | Brefeldin A | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-03891 | Cefsulodin sodium | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
