Grifolin dimethyl ether
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Others |
| Catalog number | BBF-05508 |
| CAS | 64432-03-7 |
| Molecular Weight | 356.54 |
| Molecular Formula | C24H36O2 |
| Purity | 98% |
Online Inquiry
Specification
| Synonyms | Benzene, 1,3-dimethoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyl-2,6,10-dodecatrien-1-yl]-; (2E,6E)-1-(2,6-Dimethoxy-4-methylphenyl)-3,7,11-trimethyl-2,6,10-dodecatriene; 1,3-dimethoxy-5-methyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]benzene; 2,6-dimethoxy-1-farnesyl-4-methylbenzene |
| IUPAC Name | 1,3-dimethoxy-5-methyl-2-((2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl)benzene |
| Canonical SMILES | CC1=CC(=C(C(=C1)OC)CC=C(C)CCC=C(C)CCC=C(C)C)OC |
| InChI | InChI=1S/C24H36O2/c1-18(2)10-8-11-19(3)12-9-13-20(4)14-15-22-23(25-6)16-21(5)17-24(22)26-7/h10,12,14,16-17H,8-9,11,13,15H2,1-7H3/b19-12+,20-14+ |
| InChI Key | IYVKIAUFMPWFOU-LCAIAVFMSA-N |
Properties
| Boiling Point | 469.9±33.0°C at 760 mmHg |
| Density | 0.9±0.1 g/cm3 |
Recommended Products
| BBF-03884 | Formononetin | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-04655 | Exatecan Mesylate | Inquiry |
| BBF-04624 | Sulbactam Sodium | Inquiry |
| BBF-02594 | Pyrrolnitrin | Inquiry |
| BBF-05886 | Notoginsenoside R1 | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
