Griseolutein B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Bioactive by-products |
| Catalog number | BBF-01289 |
| CAS | 2072-68-6 |
| Molecular Weight | 344.32 |
| Molecular Formula | C17H16N2O6 |
| Purity | >98% |
Online Inquiry
Description
It is produced by the strain of Streptomyces griseoluteus. Griseolutein A and Griseolutein B have similar activitiy against gram-positive and negative bacteria, and Griseolutein B also inhibits rickettsia, trichomonas vaginalis and Ehrlichite ascites cancer.
Specification
| Synonyms | 6-[(1,2-Dihydroxyethoxy)methyl]-9-methoxy-1-phenazinecarboxylic acid |
| IUPAC Name | 6-(1,2-dihydroxyethoxymethyl)-9-methoxyphenazine-1-carboxylic acid |
| Canonical SMILES | COC1=CC=C(C2=NC3=CC=CC(=C3N=C12)C(=O)O)COC(CO)O |
| InChI | InChI=1S/C17H16N2O6/c1-24-12-6-5-9(8-25-13(21)7-20)14-16(12)19-15-10(17(22)23)3-2-4-11(15)18-14/h2-6,13,20-21H,7-8H2,1H3,(H,22,23) |
| InChI Key | ZJHVCMQHJHPGMZ-UHFFFAOYSA-N |
Properties
| Appearance | Yellow Crystal |
| Antibiotic Activity Spectrum | Gram-positive bacteria; Gram-negative bacteria; Neoplastics (Tumor); Parasites |
| Boiling Point | 630.2 °C at 760 mmHg |
| Melting Point | 220 °C (dec.) |
| Density | 1.485 g/cm3 |
| Solubility | Soluble in Ethyl Acetate, Alcohol; Insoluble in Ether, Benzene, Water |
Recommended Products
| BBF-04621 | Artemisinin | Inquiry |
| BBF-03963 | Pristinamycin | Inquiry |
| BBF-02582 | Polyporenic acid C | Inquiry |
| BBF-01829 | Deoxynojirimycin | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-04609 | 1,1-Dimethylbiguanide hydrochloride | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
