Halomicin D
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01312 |
| CAS | 56413-94-6 |
| Molecular Weight | 792.91 |
| Molecular Formula | C43H56N2O12 |
Online Inquiry
Description
It is produced by the strain of Micromonospora halophytica var. nigra. It's an ansamycin antibiotic. Halomicin complex has activity against gram-positive and gram-negative bacteria (individual).
Specification
| Synonyms | N,2-Didehydro-1,4-dideoxy-1,2-dihydro-4-[(2R)-2-[(S)-1-hydroxyethyl]-1-pyrrolidinyl]-1-oxorifamycin |
| IUPAC Name | [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17-trihydroxy-27-[(2R)-2-[(1S)-1-hydroxyethyl]pyrrolidin-1-yl]-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23,29-trioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(28),2,4,9,19,21,24,26-octaen-13-yl] acetate |
| Canonical SMILES | CC1C=CC=C(C(=O)N=C2C=C(C3=C(C2=O)C(=C(C4=C3C(=O)C(O4)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)N5CCCC5C(C)O)C |
| InChI | InChI=1S/C43H56N2O12/c1-20-13-11-14-21(2)42(53)44-28-19-30(45-17-12-15-29(45)26(7)46)32-33(38(28)51)37(50)25(6)40-34(32)41(52)43(9,57-40)55-18-16-31(54-10)22(3)39(56-27(8)47)24(5)36(49)23(4)35(20)48/h11,13-14,16,18-20,22-24,26,29,31,35-36,39,46,48-50H,12,15,17H2,1-10H3/b13-11-,18-16-,21-14-,44-28?/t20-,22+,23+,24+,26-,29+,31-,35-,36+,39+,43-/m0/s1 |
| InChI Key | JAKLQGFNCDYJSC-YUBCISADSA-N |
Properties
| Appearance | Yellow Powder |
| Antibiotic Activity Spectrum | Gram-positive bacteria; Gram-negative bacteria |
| Solubility | Soluble in Benzene, Dioxane |
Recommended Products
| BBF-04736 | 3-Indolepropionic acid | Inquiry |
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-03781 | Resveratrol | Inquiry |
| BBF-03819 | Spinosyn A | Inquiry |
| BBF-03827 | Polymyxin B sulphate | Inquiry |
| BBF-04609 | 1,1-Dimethylbiguanide hydrochloride | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
