L-Histidyl-L-glutamine
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Others |
| Catalog number | BBF-05063 |
| CAS | 224638-13-5 |
| Molecular Weight | 283.28 |
| Molecular Formula | C11H17N5O4 |
| Purity | ≥95% |
Online Inquiry
Description
L-Histidyl-L-glutamine is a dipeptide consisting of histidine (His) and glutamine (Gln). Histidine is an aromatic, basic amino acid important for enzyme active sites and metal ion binding, while glutamine is a polar amino acid crucial for nitrogen metabolism and cellular function. This dipeptide may be used in studies of protein interactions, structural analysis, or as a model for exploring the effects of these amino acids in peptide-based research. Its specific sequence can influence binding properties, stability, and biological activity.
Specification
| Synonyms | HQ; Histidylglutamine; His-Gln; L-Glutamine, L-histidyl-; Histidinyl-glutamine; H-His-Gln-OH; Histidine-Glutamine dipeptide; Histidinyl-glutamine; Histidinylglutamine; L-Histidinyl-L-Glutamine |
| Sequence | His-Gln |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]-5-oxopentanoic acid |
| Canonical SMILES | C1=C(NC=N1)CC(C(=O)NC(CCC(=O)N)C(=O)O)N |
| InChI | InChI=1S/C11H17N5O4/c12-7(3-6-4-14-5-15-6)10(18)16-8(11(19)20)1-2-9(13)17/h4-5,7-8H,1-3,12H2,(H2,13,17)(H,14,15)(H,16,18)(H,19,20)/t7-,8-/m0/s1 |
| InChI Key | CTCFZNBRZBNKAX-YUMQZZPRSA-N |
Properties
| Boiling Point | 841.8±65.0 °C at 760 mmHg |
| Density | 1.426±0.06 g/cm3 |
Recommended Products
| BBF-05843 | Bacitracin | Inquiry |
| BBF-03963 | Pristinamycin | Inquiry |
| BBF-05762 | Cyclosporin B | Inquiry |
| BBF-05880 | N-Me-L-Ala-maytansinol | Inquiry |
| BBF-00586 | Brefeldin A | Inquiry |
| BBF-03921 | Staurosporine | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
