Hynapene B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Bioactive by-products |
| Catalog number | BBF-01486 |
| CAS | 155111-88-9 |
| Molecular Weight | 288.38 |
| Molecular Formula | C18H24O3 |
| Purity | 99% |
Online Inquiry
Description
Hynapene B is produced by the strain of Penicillum sp. FO-1611. The MIC (X 10-6 mol/L) for Eimeria tenella inhibition is 34.7.
Specification
| Synonyms | 5-(1-Ene-3-oxo-2,6,8-trimethyldecalin)-2,4-pentadienoic acid; 2,4-Pentadienoic acid, 5-(3,4,4a,5,6,7,8,8a-octahydro-2,6,8-trimethyl-3-oxo-1-naphthalenyl)- |
| IUPAC Name | (2E,4E)-5-(2,6,8-trimethyl-3-oxo-4a,5,6,7,8,8a-hexahydro-4H-naphthalen-1-yl)penta-2,4-dienoic acid |
| Canonical SMILES | CC1CC(C2C(C1)CC(=O)C(=C2C=CC=CC(=O)O)C)C |
| InChI | InChI=1S/C18H24O3/c1-11-8-12(2)18-14(9-11)10-16(19)13(3)15(18)6-4-5-7-17(20)21/h4-7,11-12,14,18H,8-10H2,1-3H3,(H,20,21)/b6-4+,7-5+ |
| InChI Key | NLOFDOOJCSGCEJ-YDFGWWAZSA-N |
Properties
| Appearance | Yellow Powder |
| Antibiotic Activity Spectrum | parasites |
| Boiling Point | 456.6°C at 760 mmHg |
| Density | 1.103 g/cm3 |
Reference Reading
1. Hynapenes A, B and C, new anticoccidial agents produced by Penicillium sp. I. Production, isolation and physico-chemical and biological properties
N Tabata, H Tomoda, R Masuma, K Haneda, Y Iwai, S Omura J Antibiot (Tokyo). 1993 Dec;46(12):1849-53. doi: 10.7164/antibiotics.46.1849.
Penicillium sp. FO-1611, a soil isolate, was found to produce a series of new anticoccidial compounds. Three active compounds, designated hynapenes A, B and C, were isolated from the fermentation broth of the producing strain by solvent extraction, silica gel column chromatography, gel filtration on Sephadex LH-20 and preparative HPLC. Hynapenes inhibited the growth of Eimeria tenella in an in vitro assay using BHK-21 cells as a host. No schizont in the cells was observed at concentrations ranging above 123 microM, 34.7 microM and 34.7 microM for hynapenes A, B and C, respectively.
2. Hynapenes A, B and C, new anticoccidial agents produced by Penicillium sp. II. Structure elucidation
N Tabata, H Tomoda, Y Iwai, S Omura J Antibiot (Tokyo). 1993 Dec;46(12):1854-8. doi: 10.7164/antibiotics.46.1854.
The structures of hynapenes A, B and C, novel anticoccidial agents, were determined by spectroscopic analyses. Hynapenes A, B and C were deduced to be (2E,4E)-5-(1,3,4-trihydroxy-2,6,8-trimethyldecalin)-2,4-p entadienoic acid, (2E,4E)-5-(1-ene-3-oxo-2,6,8-trimethyldecalin)-2,4-pentad ienoic acid and (2E,4E)-5-(3-ene-1-oxo-2,6,8-trimethyldecalin)-2,2,4-pent adienoic acid, respectively.
Recommended Products
| BBF-00586 | Brefeldin A | Inquiry |
| BBF-03816 | Milbemycin oxime | Inquiry |
| BBF-02594 | Pyrrolnitrin | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
| BBF-00969 | Homomycin | Inquiry |
| BBF-02575 | Pneumocandin A0 | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
