Inosamycin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01504 |
| CAS | 91465-52-0 |
| Molecular Weight | 615.63 |
| Molecular Formula | C23H45N5O14 |
Online Inquiry
Description
Inosamycin B is a broad-spectrum antimicrobial antibiotic originally isolated from Str. hygroscopicus No. J296-21. Its antibacterial activity is about half that of Inosamycin A.
Specification
| Synonyms | Bu 2659B; BMY-28163; 4-O-(2,6-Diamino-2,6-dideoxy-α-D-glucopyranosyl)-5-O-[3-O-(2,6-diamino-2,6-dideoxy-α-D-glucopyranosyl)-β-D-ribofuranosyl]-3-amino-2,3-dideoxy-D-myo-inositol |
| IUPAC Name | (2R,3S,4R,5R,6R)-5-amino-6-[(1R,2R,3S,4R,6S)-6-amino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6R)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3,4-dihydroxycyclohexyl]oxy-2-(aminomethyl)oxane-3,4-diol |
| Canonical SMILES | C1C(C(C(C(C1O)O)OC2C(C(C(O2)CO)OC3C(C(C(C(O3)CN)O)O)N)O)OC4C(C(C(C(O4)CN)O)O)N)N |
| InChI | InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)40-18-5(26)1-6(30)12(31)20(18)42-23-17(36)19(9(4-29)39-23)41-22-11(28)16(35)14(33)8(3-25)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8+,9+,10+,11+,12-,13+,14+,15+,16+,17+,18+,19+,20+,21+,22+,23-/m0/s1 |
| InChI Key | HNBFTXDNUFWYJV-RTWISQNDSA-N |
Properties
| Appearance | White Amorphous Solid |
| Melting Point | 200-206°C |
Reference Reading
1. Inosamycin, a complex of new aminoglycoside antibiotics. II. Structure determination
M Tsunakawa, M Hanada, H Tsukiura, M Konishi, H Kawaguchi J Antibiot (Tokyo). 1985 Oct;38(10):1313-21. doi: 10.7164/antibiotics.38.1313.
Structures of the new aminocyclitol antibiotics, inosamycins A, B, C, D and E, have been determined by a combination of chemical degradation and spectroscopic studies. They are structurally related to neomycin, paromomycin and ribostamycin but differ in that all the inosamycin components contain 2-deoxy-scyllo-inosamine in place of 2-deoxystreptamine in the known aminoglycoside antibiotics.
2. Inosamycin, a complex of new aminoglycoside antibiotics. I. Production, isolation and properties
M Tsunakawa, M Hanada, H Tsukiura, K Tomita, K Tomatsu, T Hoshiya, T Miyaki, M Konishi, H Kawaguchi J Antibiot (Tokyo). 1985 Oct;38(10):1302-12. doi: 10.7164/antibiotics.38.1302.
A strain of Streptomyces hygroscopicus No. J296-21 (ATCC 39150) was found to produce a complex of new antibiotics, called inosamycins, which consisted of components A, B, C, D and E. They are novel aminocyclitol antibiotics structurally related to neomycin, paromomycin and ribostamycin. The antibiotic complex and each component of inosamycin exhibit a broad antibacterial spectrum but they are inactive against most of the aminoglycoside-resistant organisms. The antibacterial activity of inosamycin A, the major component of the complex, is comparable to that of neomycin but its acute toxicity is significantly lower (ca. 1/3) than that of neomycin.
Recommended Products
| BBF-00764 | Cerebroside C | Inquiry |
| BBF-01825 | Loganin | Inquiry |
| BBF-03753 | Baicalin | Inquiry |
| BBF-02642 | Lactonamycin | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
| BBF-02614 | Nystatin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
