Kistamicin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01549 |
| CAS | 155683-51-5 |
| Molecular Weight | 1318.73 |
| Molecular Formula | C70H60ClN9O16 |
Online Inquiry
Description
Kistamicin B is produced by the strain of Microtetraspora parvasata subsp. kistna. It has antiviral effect, and its ID50 (μg/mL) against influenza virus MDCK cells and herpes simplex virus are respectively 1.8 and 30.
Specification
| Synonyms | Kistamycin B |
| IUPAC Name | (1S,22R,25R,28R,31R,42R)-34-chloro-25-(3,5-dihydroxyphenyl)-38,51-dihydroxy-22-[[(2R)-3-(4-hydroxyphenyl)-2-(2-phenylethylcarbamoylamino)propanoyl]amino]-23,26,29,44,46-pentaoxo-7,36-dioxa-18,24,27,30,43,45-hexazanonacyclo[29.13.2.23,6.232,35.18,12.113,17.137,41.010,28.016,20]tripentaconta-3(53),4,6(52),8,10,12(51),13(50),14,16,19,32,34,37,39,41(47),48-hexadecaene-42-carboxylic acid |
| Canonical SMILES | C1C2C(=O)NC(C3=CC(=C(C=C3)O)OC4=C(C=C(C=C4)C(C(=O)N2)NC(=O)C5C6=CC(=C(C(=C6)OC7=CC=C1C=C7)O)C8=CC9=C(C=C8)C(=CN9)CC(C(=O)NC(C(=O)N5)C1=CC(=CC(=C1)O)O)NC(=O)C(CC1=CC=C(C=C1)O)NC(=O)NCCC1=CC=CC=C1)Cl)C(=O)O |
| InChI | InChI=1S/C70H60ClN9O16/c71-49-27-38-12-19-55(49)96-56-30-39(11-18-54(56)84)61(69(92)93)80-64(87)51-22-36-8-15-46(16-9-36)95-57-31-41-26-48(62(57)85)37-10-17-47-42(33-73-50(47)28-37)29-53(74-63(86)52(23-35-6-13-43(81)14-7-35)76-70(94)72-21-20-34-4-2-1-3-5-34)65(88)77-59(40-24-44(82)32-45(83)25-40)67(90)79-60(41)68(91)78-58(38)66(89)75-51/h1-19,24-28,30-33,51-53,58-61,73,81-85H,20-23,29H2,(H,74,86)(H,75,89)(H,77,88)(H,78,91)(H,79,90)(H,80,87)(H,92,93)(H2,72,76,94)/t51-,52+,53+,58+,59+,60+,61+/m0/s1 |
| InChI Key | ACUGLGSAQKAJRT-KZGAUPIUSA-N |
Properties
| Appearance | Pale Yellow Powder |
| Antibiotic Activity Spectrum | viruses |
| Melting Point | >300°C |
Reference Reading
1. New antiviral antibiotics, kistamicins A and B. I. Taxonomy, production, isolation, physico-chemical properties and biological activities
N Naruse, O Tenmyo, S Kobaru, M Hatori, K Tomita, Y Hamagishi, T Oki J Antibiot (Tokyo). 1993 Dec;46(12):1804-11. doi: 10.7164/antibiotics.46.1804.
A new strain of Microtetraspora parvosata subsp. kistnae subsp. nov. (ATCC 55076) was found to produce new antiviral antibiotics, designated kistamicins A and B. These antibiotics exhibited activity against influenza virus type A and moderate activity against Gram-positive bacteria.
2. New antiviral antibiotics, kistamicins A and B. II. Structure determination
N Naruse, M Oka, M Konishi, T Oki J Antibiot (Tokyo). 1993 Dec;46(12):1812-8. doi: 10.7164/antibiotics.46.1812.
The structures of antiviral antibiotics kistamicins A and B have been determined by a combination of chemical degradation and spectral analysis. They are commonly composed of D-tyrosine, 3,5-dihydrophenylglycine, a biphenyl ether bis-amino acid, and a diphenyl substituted indole tris-amino acid, forming a tricyclic ring structure. Kistamicin B possessed a phenethylamide at the amino terminal of kistamicin A. They are structurally related to the nuclei of the vancomycin group antibiotics particularly to antibiotic complestatin.
Recommended Products
| BBF-05886 | Notoginsenoside R1 | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-03816 | Milbemycin oxime | Inquiry |
| BBF-05806 | Zeaxanthin | Inquiry |
| BBF-01737 | Cordycepin | Inquiry |
| BBF-01825 | Loganin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
