Maniwamycin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-02293 |
| CAS | 122547-71-1 |
| Molecular Weight | 200.28 |
| Molecular Formula | C10H20N2O2 |
Online Inquiry
Description
It is produced by the strain of Str. prasinopilosus KC-7367. It has anti-fungal effect. Maniwamycin B has weaker anti-fungal effect than Maniwamycin A, but it has no anti-bacterial effect.
Specification
| Synonyms | Antibiotic KA 7367B; KA 7367B; (S-(R*,R*-(Z,E)))-3-(1-Hexenyl-ONN-azoxy)-2-butanol; 2-Butanol, 3-(1-hexenyl-ONN-azoxy)-, (S-(R*,R*-(Z,E)))- |
| IUPAC Name | [(E)-hex-1-enyl]-[(2S,3S)-3-hydroxybutan-2-yl]imino-oxidoazanium |
| Canonical SMILES | CCCCC=C[N+](=NC(C)C(C)O)[O-] |
| InChI | InChI=1S/C10H20N2O2/c1-4-5-6-7-8-12(14)11-9(2)10(3)13/h7-10,13H,4-6H2,1-3H3/b8-7+,12-11?/t9-,10-/m0/s1 |
| InChI Key | YSGFBXZSDXVSLM-IZPMOTALSA-N |
Properties
| Appearance | Colorless Oily Matter |
| Antibiotic Activity Spectrum | Fungi |
| Boiling Point | 300.7°C at 760 mmHg |
| Density | 0.99 g/cm3 |
| Solubility | Soluble in Chloroform, Ethanol |
Reference Reading
1. Novel antifungal antibiotics maniwamycins A and B. I. Taxonomy of the producing organism, fermentation, isolation, physico-chemical properties and biological properties
M Nakayama, Y Takahashi, H Itoh, K Kamiya, M Shiratsuchi, G Otani J Antibiot (Tokyo). 1989 Nov;42(11):1535-40. doi: 10.7164/antibiotics.42.1535.
Two antifungal antibiotics maniwamycins A and B were isolated from the culture broth of a strain of actinomycetes, which were classified as Streptomyces prasinopilosus. These antibiotics were isolated by resin absorption and extraction with EtOAc and purified by column chromatography. Both antibiotics were found to be new azoxy substances from their physico-chemical properties. They showed broad antifungal spectra.
2. Novel antifungal antibiotics maniwamycins A and B. II. Structure determination
Y Takahashi, M Nakayama, I Watanabe, T Deushi, H Ishiwata, M Shiratsuchi, G Otani J Antibiot (Tokyo). 1989 Nov;42(11):1541-6. doi: 10.7164/antibiotics.42.1541.
The structures of the new azoxy antibiotics maniwamycins A and B have been determined by means of spectral analyses and chemical studies.
Recommended Products
| BBF-03868 | Honokiol | Inquiry |
| BBF-04009 | Nigericin sodium | Inquiry |
| BBF-04624 | Sulbactam Sodium | Inquiry |
| BBF-02576 | Pneumocandin B0 | Inquiry |
| BBF-05886 | Notoginsenoside R1 | Inquiry |
| BBF-03908 | Miltefosine | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
