Mycoplanecin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-01973 |
| CAS | 81018-84-0 |
| Molecular Weight | 1169.49 |
| Molecular Formula | C60H100N10O13 |
Online Inquiry
Description
Mycoplanecin B is a cyclic peptide antibiotic produced by Actinoplanes aivajinensis subsp. mycoplanecinus.
Specification
| Synonyms | 2-(4-Methylproline)mycoplanecin A |
| IUPAC Name | N,4-dimethyl-1-[3-methyl-2-[methyl(2-oxobutanoyl)amino]butanoyl]-N-[4,11,19,26-tetramethyl-6-(3-methylbutyl)-15,25-bis(2-methylpropyl)-2,5,8,14,17,21,24,27-octaoxo-3-propan-2-yl-20-oxa-1,4,7,13,16,23,26-heptazatricyclo[26.3.0.09,13]hentriacontan-18-yl]pyrrolidine-2-carboxamide |
| Canonical SMILES | CCC(=O)C(=O)N(C)C(C(C)C)C(=O)N1CC(CC1C(=O)N(C)C2C(OC(=O)CNC(=O)C(N(C(=O)C3CCCN3C(=O)C(N(C(=O)C(NC(=O)C4CC(CN4C(=O)C(NC2=O)CC(C)C)C)CCC(C)C)C)C(C)C)C)CC(C)C)C)C |
| InChI | InChI=1S/C60H100N10O13/c1-19-46(71)58(80)66(17)49(36(10)11)60(82)70-31-38(13)28-45(70)57(79)67(18)50-39(14)83-47(72)29-61-51(73)43(26-34(6)7)64(15)56(78)42-21-20-24-68(42)59(81)48(35(8)9)65(16)54(76)40(23-22-32(2)3)62-52(74)44-27-37(12)30-69(44)55(77)41(25-33(4)5)63-53(50)75/h32-45,48-50H,19-31H2,1-18H3,(H,61,73)(H,62,74)(H,63,75) |
| InChI Key | JIGXVESWGUAPCN-UHFFFAOYSA-N |
Recommended Products
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-04301 | Tulathromycin A | Inquiry |
| BBF-03756 | Amygdalin | Inquiry |
| BBF-05827 | Spliceostatin A | Inquiry |
| BBF-03794 | Geneticin sulfate | Inquiry |
| BBF-03800 | Moxidectin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
