Octacosamicin A
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-02144 |
| CAS | 122005-25-8 |
| Molecular Weight | 624.76 |
| Molecular Formula | C31H52N4O9 |
| Purity | >95% |
Online Inquiry
Description
Octacosamicin A is originally isolated from Amycolatops azurea MG 398-hF9 (FERM P-8865). It has the function of resisting bacterium, yeast, and filamentous fungus, but the function of resisting bacterium is weak.
Specification
| Synonyms | Antibiotic MG 398HF9A; Glycine, N-(28-((aminoiminomethyl)hydroxyamino)-2,3,5,7-tetrahydroxy-1,19-dioxo-12,14,20,22-octacosatetraenyl)- |
| IUPAC Name | 2-[[(12E,14E,20E,22E)-28-[carbamimidoyl(hydroxy)amino]-2,3,5,7-tetrahydroxy-19-oxooctacosa-12,14,20,22-tetraenoyl]amino]acetic acid |
| Canonical SMILES | C(CCC=CC=CC(=O)CCCC=CC=CCCCCC(CC(CC(C(C(=O)NCC(=O)O)O)O)O)O)CCN(C(=N)N)O |
| InChI | InChI=1S/C31H52N4O9/c32-31(33)35(44)20-16-12-8-4-7-10-14-18-24(36)17-13-9-5-2-1-3-6-11-15-19-25(37)21-26(38)22-27(39)29(42)30(43)34-23-28(40)41/h1-3,5,7,10,14,18,25-27,29,37-39,42,44H,4,6,8-9,11-13,15-17,19-23H2,(H3,32,33)(H,34,43)(H,40,41)/b3-1+,5-2+,10-7+,18-14+ |
| InChI Key | JHJDTYDBQYAKEF-NMPSDRPFSA-N |
Properties
| Appearance | Colorless Amorphous Powder |
| Antibiotic Activity Spectrum | fungi; yeast |
| Melting Point | 152-162°C |
Reference Reading
1. Novel antifungal antibiotics octacosamicins A and B. I. Taxonomy, fermentation and isolation, physico-chemical properties and biological activities
K Dobashi, N Matsuda, M Hamada, H Naganawa, T Takita, T Takeuchi J Antibiot (Tokyo). 1988 Nov;41(11):1525-32. doi: 10.7164/antibiotics.41.1525.
Two antifungal antibiotics octacosamicins A and B were isolated from the culture broth of a strain of actinomycetes, which was identified as a strain of Amycolatopsis. These antibiotics were isolated by resin adsorption and purified by column chromatography and preparative HPLC. Both antibiotics were found to be new substances from their physico-chemical properties. They showed broad antifungal spectra.
2. Novel antifungal antibiotics octacosamicins A and B. II. The structure elucidation using various NMR spectroscopic methods
K Dobashi, H Naganawa, Y Takahashi, T Takita, T Takeuchi J Antibiot (Tokyo). 1988 Nov;41(11):1533-41. doi: 10.7164/antibiotics.41.1533.
The structures of octacosamicins A and B, two new antifungal antibiotics, were studied by spectrometries and chemical modifications. The 2D NMR techniques including 1H-detected heteronuclear multiple bond correlation method were successfully applied to this study. These antibiotics have unique linear chain structure possessing N-hydroxyguanidyl group at the terminal.
Recommended Products
| BBF-03963 | Pristinamycin | Inquiry |
| BBF-04736 | 3-Indolepropionic acid | Inquiry |
| BBF-00693 | Ansamitocin P-3 | Inquiry |
| BBF-01829 | Deoxynojirimycin | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
| BBF-03516 | (±)-Naringenin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
