Octacosamicin B
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-02145 |
| CAS | 122005-24-7 |
| Molecular Weight | 638.79 |
| Molecular Formula | C32H54N4O9 |
Online Inquiry
Description
Octacosamicin B is originally isolated from Amycolatops azurea MG 398-hF9 (FERM P-8865). It has the function of resisting bacterium, yeast, and filamentous fungus, but the function of resisting bacterium is weak.
Specification
| IUPAC Name | 2-[[(12E,14E,20E,22E)-28-[carbamimidoyl(hydroxy)amino]-2,3,5,7-tetrahydroxy-8-methyl-19-oxooctacosa-12,14,20,22-tetraenoyl]amino]acetic acid |
| Canonical SMILES | CC(CCCC=CC=CCCCC(=O)C=CC=CCCCCCN(C(=N)N)O)C(CC(CC(C(C(=O)NCC(=O)O)O)O)O)O |
| InChI | InChI=1S/C32H54N4O9/c1-24(27(39)21-26(38)22-28(40)30(43)31(44)35-23-29(41)42)17-13-9-5-2-3-6-10-14-18-25(37)19-15-11-7-4-8-12-16-20-36(45)32(33)34/h2-3,5-7,11,15,19,24,26-28,30,38-40,43,45H,4,8-10,12-14,16-18,20-23H2,1H3,(H3,33,34)(H,35,44)(H,41,42)/b5-2+,6-3+,11-7+,19-15+ |
| InChI Key | YRBWJHGUKBSDDE-RLZHPBLRSA-N |
Properties
| Appearance | Colorless Amorphous Powder |
| Antibiotic Activity Spectrum | fungi; yeast |
| Melting Point | 92-107°C |
Reference Reading
1. Novel antifungal antibiotics octacosamicins A and B. II. The structure elucidation using various NMR spectroscopic methods
K Dobashi, H Naganawa, Y Takahashi, T Takita, T Takeuchi J Antibiot (Tokyo). 1988 Nov;41(11):1533-41. doi: 10.7164/antibiotics.41.1533.
The structures of octacosamicins A and B, two new antifungal antibiotics, were studied by spectrometries and chemical modifications. The 2D NMR techniques including 1H-detected heteronuclear multiple bond correlation method were successfully applied to this study. These antibiotics have unique linear chain structure possessing N-hydroxyguanidyl group at the terminal.
2. Novel antifungal antibiotics octacosamicins A and B. I. Taxonomy, fermentation and isolation, physico-chemical properties and biological activities
K Dobashi, N Matsuda, M Hamada, H Naganawa, T Takita, T Takeuchi J Antibiot (Tokyo). 1988 Nov;41(11):1525-32. doi: 10.7164/antibiotics.41.1525.
Two antifungal antibiotics octacosamicins A and B were isolated from the culture broth of a strain of actinomycetes, which was identified as a strain of Amycolatopsis. These antibiotics were isolated by resin adsorption and purified by column chromatography and preparative HPLC. Both antibiotics were found to be new substances from their physico-chemical properties. They showed broad antifungal spectra.
Recommended Products
| BBF-03827 | Polymyxin B sulphate | Inquiry |
| BBF-02594 | Pyrrolnitrin | Inquiry |
| BBF-03211 | AT-265 | Inquiry |
| BBF-05817 | Astaxanthin | Inquiry |
| BBF-03756 | Amygdalin | Inquiry |
| BBF-03884 | Formononetin | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
