Pradimicin Q
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-02054 |
| CAS | 141869-53-6 |
| Molecular Weight | 464.38 |
| Molecular Formula | C24H16O10 |
Online Inquiry
Description
Pradimicin Q is an antibiotic produced by Actinomadura verrucosospora subsp. neohibisca R 103-3. The cytotoxicity (IC50) to human colon HCT-116 cells and murine melanoma B16-F10 cells are 75 and 100 μg/mL, respectively.
Specification
| Synonyms | Benzo(a)naphthacene-2-carboxylic acid, 5,6,8,13-tetrahydro-1,5,7,9,11,14-hexahydroxy-3-methyl-8,13-dioxo- |
| IUPAC Name | (5R)-1,5,7,9,11,14-hexahydroxy-3-methyl-8,13-dioxo-5,6-dihydrobenzo[a]tetracene-2-carboxylic acid |
| Canonical SMILES | CC1=CC2=C(C3=C(CC2O)C(=C4C(=C3O)C(=O)C5=C(C4=O)C(=CC(=C5)O)O)O)C(=C1C(=O)O)O |
| InChI | InChI=1S/C24H16O10/c1-6-2-8-11(26)5-10-16(15(8)21(30)13(6)24(33)34)23(32)18-17(20(10)29)22(31)14-9(19(18)28)3-7(25)4-12(14)27/h2-4,11,25-27,29-30,32H,5H2,1H3,(H,33,34)/t11-/m1/s1 |
| InChI Key | QJLPWVUZFKETMK-LLVKDONJSA-N |
Properties
| Appearance | Red Powder |
| Antibiotic Activity Spectrum | neoplastics (Tumor) |
| Boiling Point | 885.2±65.0°C at 760 mmHg |
| Melting Point | >200°C (dec.) |
| Density | 1.8±0.1 g/cm3 |
Recommended Products
| BBF-03516 | (±)-Naringenin | Inquiry |
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-02582 | Polyporenic acid C | Inquiry |
| BBF-03428 | Tubermycin B | Inquiry |
| BBF-03827 | Polymyxin B sulphate | Inquiry |
| BBF-03774 | Cephalosporin C Zinc Salt | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
