Primocarcin
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Antibiotics |
| Catalog number | BBF-02059 |
| CAS | 3750-26-3 |
| Molecular Weight | 184.19 |
| Molecular Formula | C8H12N2O3 |
Online Inquiry
Description
Primocarcin is an antibiotic produced by Nocardia fukayea 11-41. Antibacterial effect is weak; inoculated with Ehrlich ascites cancer mice intraperitoneally given 0.125-0. 5mg/mouse/day, ascites does not increase, and survival time is more than doubled. For Sarcoma-180, given the same dose, the same effect was achieved.
Specification
| Synonyms | 5-(Acetylamino)-4-oxo-5-hexenamide; 4-Acetamido-4-penten-3-one-1-carboxamide |
| IUPAC Name | 5-acetamido-4-oxohex-5-enamide |
| Canonical SMILES | CC(=O)NC(=C)C(=O)CCC(=O)N |
| InChI | InChI=1S/C8H12N2O3/c1-5(10-6(2)11)7(12)3-4-8(9)13/h1,3-4H2,2H3,(H2,9,13)(H,10,11) |
| InChI Key | DVMKENULKFKEFR-UHFFFAOYSA-N |
Properties
| Appearance | Colorless Needle Crystal |
| Antibiotic Activity Spectrum | neoplastics (Tumor) |
| Boiling Point | 544.5°C at 760 mmHg |
| Melting Point | 130-131°C |
| Density | 1.155 g/cm3 |
Recommended Products
| BBF-00574 | Bestatin | Inquiry |
| BBF-01210 | Emericid | Inquiry |
| BBF-00569 | Aspoxicillin | Inquiry |
| BBF-02577 | Pneumocandin C0 | Inquiry |
| BBF-05762 | Cyclosporin B | Inquiry |
| BBF-05753 | Cyclosporin D | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
