Catalog number:
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
It is produced by the strain of Nocardia sp. C-15003(N-1). It has the function of anti-tumor, anti-plant pathogenic fungi, skin fungi and protozoa, and has no antibacterial activity.
- Specification
- Recommended Products
| Catalog Number | BBF-03360 |
| CAS | 135161-99-8 |
| Description | R1128 D is a non-steroidal estrogen-receptor antagonist produced by Streptomyces sp. No. 1128. The IC50 value of R1128 D for partially purified rat uterine cytosol receptor was 2.7 x 10(-7) M. |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.3 |
| Synonyms | R1128D; R-1128D |
| IUPAC Name | 1,3,6-trihydroxy-8-pentylanthracene-9,10-dione |
| Canonical SMILES | CCCCCC1=C2C(=CC(=C1)O)C(=O)C3=C(C2=O)C(=CC(=C3)O)O |
| InChI | InChI=1S/C19H18O5/c1-2-3-4-5-10-6-11(20)7-13-16(10)19(24)17-14(18(13)23)8-12(21)9-15(17)22/h6-9,20-22H,2-5H2,1H3 |
| InChI Key | BAAGPGLSSCBBBB-UHFFFAOYSA-N |
| Melting Point | 237-242°C |
| Appearance | Brown Powder |
| BBF-01090 | Cuevaene B | Inquiry |
| BBF-05614 | Prasinic acid | Inquiry |
| BBF-00191 | Butirosin B | Inquiry |
| BBF-00782 | Dactylocycline D | Inquiry |
| BBF-01073 | Crinipellin A | Inquiry |
| BBF-02364 | Papyracon III | Inquiry |
| BBF-04006 | Sulfadoxine | Inquiry |
| BBF-04078 | Germacrone | Inquiry |
