Spiro[4.5]dec-7-ene, 1-(1,5-dimethylhexyl)-4,8-dimethyl-, [1R-[1α(R*),4β,5β]]-
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
![Spiro[4.5]dec-7-ene, 1-(1,5-dimethylhexyl)-4,8-dimethyl-, [1R-[1α(R*),4β,5β]]-](https://resource.bocsci.com/structure/90363-98-7.gif)
| Category | Others |
| Catalog number | BBF-05638 |
| CAS | 90363-98-7 |
| Molecular Weight | 276.50 |
| Molecular Formula | C20H36 |
Online Inquiry
Specification
| Synonyms | Spiro[4.5]dec-7-ene, 1-(1,5-dimethylhexyl)-4,8-dimethyl-, [1R-[1alpha(R*),4beta,5beta]]- |
| IUPAC Name | (1S,4R,5R)-1,8-dimethyl-4-(6-methylheptan-2-yl)spiro[4.5]dec-7-ene |
| InChI | InChI=1S/C20H36/c1-15(2)7-6-8-17(4)19-10-9-18(5)20(19)13-11-16(3)12-14-20/h11,15,17-19H,6-10,12-14H2,1-5H3/t17-,18+,19-,20-/m1/s1 |
| InChI Key | CJKIDWOLAMBHIK-IYWMVGAKSA-N |
Recommended Products
| BBF-05808 | Triptolide | Inquiry |
| BBF-03862 | Cefozopran hydrochloride | Inquiry |
| BBF-03774 | Cephalosporin C Zinc Salt | Inquiry |
| BBF-04621 | Artemisinin | Inquiry |
| BBF-04736 | 3-Indolepropionic acid | Inquiry |
| BBF-05827 | Spliceostatin A | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
