WS75624 A
* Please be kindly noted products are not for therapeutic use. We do not sell to patients.
| Category | Enzyme inhibitors |
| Catalog number | BBF-01656 |
| CAS | |
| Molecular Weight | 380.5 |
| Molecular Formula | C18H24N2O5S |
Online Inquiry
Description
WS75624 A is an endothelin converting enzyme (ECE) inhibitor isolated from the fermentation broth of Saccharothrix sp. No. 75624. It also showed other metalloprotease (collagenase and neutral endopeptidase) inhibitory activity with IC50 value of 1 mM/ml.
Specification
| Synonyms | WS-75624 A; WS 75624 A; WS-75624A |
| IUPAC Name | 6-[2-(5-hydroxy-5-methylhexyl)-1,3-thiazol-4-yl]-4,5-dimethoxypyridine-2-carboxylic acid |
| Canonical SMILES | CC(C)(CCCCC1=NC(=CS1)C2=C(C(=CC(=N2)C(=O)O)OC)OC)O |
| InChI | InChI=1S/C18H24N2O5S/c1-18(2,23)8-6-5-7-14-19-12(10-26-14)15-16(25-4)13(24-3)9-11(20-15)17(21)22/h9-10,23H,5-8H2,1-4H3,(H,21,22) |
| InChI Key | XAJOGJGSQJPCNH-UHFFFAOYSA-N |
Properties
| Appearance | Solid Powder |
| Melting Point | 53-54°C |
Reference Reading
1. WS75624 A and B, new endothelin converting enzyme inhibitors isolated from Saccharothrix sp. No. 75624. II. Structure elucidation of WS75624 A and B
S Yoshimura, Y Tsurumi, S Takase, M Okuhara J Antibiot (Tokyo). 1995 Oct;48(10):1073-5. doi: 10.7164/antibiotics.48.1073.
The structures of WS75624 A and B, novel endothelin converting enzyme inhibitors, were determined to be 1 and 2A, respectively, by a combination of chemical evidence and a series of 2D NMR spectral analyses.
2. WS75624 A and B, new endothelin converting enzyme inhibitors isolated from Saccharothrix sp. No. 75624. I. Taxonomy, fermentation, isolation, physico-chemical properties and biological activities
Y Tsurumi, H Ueda, K Hayashi, S Takase, M Nishikawa, S Kiyoto, M Okuhara J Antibiot (Tokyo). 1995 Oct;48(10):1066-72. doi: 10.7164/antibiotics.48.1066.
Novel endothelin converting enzyme (ECE) inhibitors, WS75624 A and B, have been isolated from the fermentation broth of Saccharothrix sp. No. 75624. These inhibitors were purified from an acetone extract of whole culture broth followed by HP-20 column chromatography, silica gel column chromatography and HPLC. WS75624 A and B showed highly potent ECE inhibitory activity, and both had IC50 values of 0.03 microgram/ml. WS75624 A and B also showed other metalloprotease (collagenase and neutral endopeptidase) inhibitory activity with IC50 values of 1 microgram/ml. Since large amount of WS75624 B was isolated, we tried in vivo evaluation using WS75624 B. WS75624 B inhibited big endothelin-induced pressor effect when administered to SD rat intravenously with big ET-1.
Recommended Products
| BBF-03963 | Pristinamycin | Inquiry |
| BBF-05818 | Docosahexaenoic acid | Inquiry |
| BBF-03800 | Moxidectin | Inquiry |
| BBF-05877 | Coenzyme Q10 | Inquiry |
| BBF-03755 | Actinomycin D | Inquiry |
| BBF-02577 | Pneumocandin C0 | Inquiry |
Bio Calculators
* Our calculator is based on the following equation:
Concentration (start) x Volume (start) = Concentration (final) x Volume (final)
It is commonly abbreviated as: C1V1 = C2V2
* Total Molecular Weight:
g/mol
Tip: Chemical formula is case sensitive. C22H30N4O √ c22h30n40 ╳
